C24H19F2N3O2 — CID 154667306
6-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2H-phthalazin-1-one (PubChem CID 154667306) has the molecular formula C24H19F2N3O2 and a molecular weight of 419.43 g/mol. Its IUPAC name is 6-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2H-phthalazin-1-one.
| Compound Name | 6-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 154667306 |
| Molecular Formula | C24H19F2N3O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 6-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-2H-phthalazin-1-one |
| SMILES | O=C(c1ccc2c(-c3ccc4c(=O)[nH]ncc4c3)cccc2c1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C24H19F2N3O2/c25-24(26)8-10-29(11-9-24)23(31)17-5-6-20-15(12-17)2-1-3-19(20)16-4-7-21-18(13-16)14-27-28-22(21)30/h1-7,12-14H,8-11H2,(H,28,30) |
| InChIKey | CJSHBZYAJXFXQA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |