C23H27N3O2 — CID 154667394
2-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 154667394) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 154667394 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[6-(piperidine-1-carbonyl)naphthalen-1-yl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C(c1ccc2c(N3CCN4C(=O)CCC4C3)cccc2c1)N1CCCCC1 |
| InChI | InChI=1S/C23H27N3O2/c27-22-10-8-19-16-25(13-14-26(19)22)21-6-4-5-17-15-18(7-9-20(17)21)23(28)24-11-2-1-3-12-24/h4-7,9,15,19H,1-3,8,10-14,16H2 |
| InChIKey | QVKKXBJOAZOJSB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |