C16H27NO2 — CID 154669853
tert-butyl 1-(2,2-dimethylbut-3-enyl)-3-methyl-2H-pyrrole-3-carboxylate (PubChem CID 154669853) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is tert-butyl 1-(2,2-dimethylbut-3-enyl)-3-methyl-2H-pyrrole-3-carboxylate.
| Compound Name | tert-butyl 1-(2,2-dimethylbut-3-enyl)-3-methyl-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 154669853 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | tert-butyl 1-(2,2-dimethylbut-3-enyl)-3-methyl-2H-pyrrole-3-carboxylate |
| SMILES | C=CC(C)(C)CN1C=CC(C)(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27NO2/c1-8-15(5,6)11-17-10-9-16(7,12-17)13(18)19-14(2,3)4/h8-10H,1,11-12H2,2-7H3 |
| InChIKey | IWYPILRZJHPUJL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|