C45H57N5O5 — CID 154670594
5-[4-[2-[1-[[4-[6-(diethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]methyl]azocan-4-yl]ethyl]piperidin-1-yl]indene-1,3-dione (PubChem CID 154670594) has the molecular formula C45H57N5O5 and a molecular weight of 747.98 g/mol. Its IUPAC name is 5-[4-[2-[1-[[4-[6-(diethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]methyl]azocan-4-yl]ethyl]piperidin-1-yl]indene-1,3-dione.
| Compound Name | 5-[4-[2-[1-[[4-[6-(diethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]methyl]azocan-4-yl]ethyl]piperidin-1-yl]indene-1,3-dione |
|---|---|
| PubChem CID | 154670594 |
| Molecular Formula | C45H57N5O5 |
| Molecular Weight | 747.98 g/mol |
| Exact Mass | 747.44 |
| IUPAC Name | 5-[4-[2-[1-[[4-[6-(diethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]methyl]azocan-4-yl]ethyl]piperidin-1-yl]indene-1,3-dione |
| SMILES | CCN(CC)c1cc2c(-c3cc(OC)c(CN4CCCCC(CCC5CCN(c6ccc7c(c6)C(=O)CC7=O)CC5)CC4)c(OC)c3)cn(C)c(=O)c2cn1 |
| InChI | InChI=1S/C45H57N5O5/c1-6-49(7-2)44-25-35-37(27-46-44)45(53)47(3)28-38(35)32-22-42(54-4)39(43(23-32)55-5)29-48-18-9-8-10-30(15-19-48)11-12-31-16-20-50(21-17-31)33-13-14-34-36(24-33)41(52)26-40(34)51/h13-14,22-25,27-28,30-31H,6-12,15-21,26,29H2,1-5H3 |
| InChIKey | SACPQMFKFICQED-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 97.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.98 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|