C41H48ClN5O4 — CID 164719886
3-[4-[4-[2-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 164719886) has the molecular formula C41H48ClN5O4 and a molecular weight of 710.32 g/mol. Its IUPAC name is 3-[4-[4-[2-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164719886 |
| Molecular Formula | C41H48ClN5O4 |
| Molecular Weight | 710.32 g/mol |
| Exact Mass | 709.34 |
| IUPAC Name | 3-[4-[4-[2-[1-[[2-chloro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3ccccc23)cc(Cl)c1CN1CCC(CCC2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C41H48ClN5O4/c1-45-25-34(32-5-3-4-6-33(32)41(45)50)29-23-36(42)35(38(24-29)51-2)26-46-19-15-27(16-20-46)7-8-28-17-21-47(22-18-28)31-11-9-30(10-12-31)43-37-13-14-39(48)44-40(37)49/h3-6,9-12,23-25,27-28,37,43H,7-8,13-22,26H2,1-2H3,(H,44,48,49) |
| InChIKey | OQRCYSVKMLJSDS-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.32 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|