C39H42F3N5O4 — CID 164720433
3-[4-[4-[1-[[4-(2-methyl-1-oxoisoquinolin-4-yl)-2-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 164720433) has the molecular formula C39H42F3N5O4 and a molecular weight of 701.79 g/mol. Its IUPAC name is 3-[4-[4-[1-[[4-(2-methyl-1-oxoisoquinolin-4-yl)-2-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[1-[[4-(2-methyl-1-oxoisoquinolin-4-yl)-2-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164720433 |
| Molecular Formula | C39H42F3N5O4 |
| Molecular Weight | 701.79 g/mol |
| Exact Mass | 701.32 |
| IUPAC Name | 3-[4-[4-[1-[[4-(2-methyl-1-oxoisoquinolin-4-yl)-2-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | Cn1cc(-c2ccc(CN3CCC(C4CCN(c5ccc(NC6CCC(=O)NC6=O)cc5)CC4)CC3)c(OC(F)(F)F)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C39H42F3N5O4/c1-45-24-33(31-4-2-3-5-32(31)38(45)50)27-6-7-28(35(22-27)51-39(40,41)42)23-46-18-14-25(15-19-46)26-16-20-47(21-17-26)30-10-8-29(9-11-30)43-34-12-13-36(48)44-37(34)49/h2-11,22,24-26,34,43H,12-21,23H2,1H3,(H,44,48,49) |
| InChIKey | KPWRCDQCPCDYKU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.79 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|