C41H44F4N4O4 — CID 164720098
3-[4-[4-[4-[[2-fluoro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]cyclohexyl]piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione (PubChem CID 164720098) has the molecular formula C41H44F4N4O4 and a molecular weight of 732.82 g/mol. Its IUPAC name is 3-[4-[4-[4-[[2-fluoro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]cyclohexyl]piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[4-[[2-fluoro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]cyclohexyl]piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164720098 |
| Molecular Formula | C41H44F4N4O4 |
| Molecular Weight | 732.82 g/mol |
| Exact Mass | 732.33 |
| IUPAC Name | 3-[4-[4-[4-[[2-fluoro-6-methoxy-4-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]methyl]cyclohexyl]piperidin-1-yl]-3-(trifluoromethyl)anilino]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3ccccc23)cc(F)c1CC1CCC(C2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C41H44F4N4O4/c1-48-23-32(29-5-3-4-6-30(29)40(48)52)27-20-34(42)31(37(21-27)53-2)19-24-7-9-25(10-8-24)26-15-17-49(18-16-26)36-13-11-28(22-33(36)41(43,44)45)46-35-12-14-38(50)47-39(35)51/h3-6,11,13,20-26,35,46H,7-10,12,14-19H2,1-2H3,(H,47,50,51) |
| InChIKey | HNQCVFPIVVSRDB-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.82 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|