C39H35N5O7 — CID 154670796
5-[2-[1-[[4-(6-cyclopropyl-2-methyl-1-oxo-2,7-naphthyridin-4-yl)-2,6-dimethoxyphenyl]methyl]azetidin-3-yl]ethynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 154670796) has the molecular formula C39H35N5O7 and a molecular weight of 685.74 g/mol. Its IUPAC name is 5-[2-[1-[[4-(6-cyclopropyl-2-methyl-1-oxo-2,7-naphthyridin-4-yl)-2,6-dimethoxyphenyl]methyl]azetidin-3-yl]ethynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[2-[1-[[4-(6-cyclopropyl-2-methyl-1-oxo-2,7-naphthyridin-4-yl)-2,6-dimethoxyphenyl]methyl]azetidin-3-yl]ethynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 154670796 |
| Molecular Formula | C39H35N5O7 |
| Molecular Weight | 685.74 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | 5-[2-[1-[[4-(6-cyclopropyl-2-methyl-1-oxo-2,7-naphthyridin-4-yl)-2,6-dimethoxyphenyl]methyl]azetidin-3-yl]ethynyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnc(C4CC4)cc23)cc(OC)c1CN1CC(C#Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C39H35N5O7/c1-42-19-29(26-15-31(23-7-8-23)40-16-28(26)37(42)47)24-13-33(50-2)30(34(14-24)51-3)20-43-17-22(18-43)5-4-21-6-9-25-27(12-21)39(49)44(38(25)48)32-10-11-35(45)41-36(32)46/h6,9,12-16,19,22-23,32H,7-8,10-11,17-18,20H2,1-3H3,(H,41,45,46) |
| InChIKey | MXAGRYDCJNNIRR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|