C36H36N6O7S — CID 167371049
5-[7-[[2,6-dimethoxy-4-(5-methyl-4-oxo-[1,2]thiazolo[4,5-c]pyridin-7-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167371049) has the molecular formula C36H36N6O7S and a molecular weight of 696.79 g/mol. Its IUPAC name is 5-[7-[[2,6-dimethoxy-4-(5-methyl-4-oxo-[1,2]thiazolo[4,5-c]pyridin-7-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[7-[[2,6-dimethoxy-4-(5-methyl-4-oxo-[1,2]thiazolo[4,5-c]pyridin-7-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167371049 |
| Molecular Formula | C36H36N6O7S |
| Molecular Weight | 696.79 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | 5-[7-[[2,6-dimethoxy-4-(5-methyl-4-oxo-[1,2]thiazolo[4,5-c]pyridin-7-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnsc23)cc(OC)c1CN1CCC2(CC1)CN(c1ccc3c(c1)C(=O)N(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C36H36N6O7S/c1-39-16-25(31-24(33(39)45)15-37-50-31)20-12-28(48-2)26(29(13-20)49-3)17-40-10-8-36(9-11-40)18-41(19-36)21-4-5-22-23(14-21)35(47)42(34(22)46)27-6-7-30(43)38-32(27)44/h4-5,12-16,27H,6-11,17-19H2,1-3H3,(H,38,43,44) |
| InChIKey | COYOLRRHBQJLEM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|