C39H44N6O7 — CID 154672600
5-[7-[[1-[[2,6-dimethoxy-4-(1-methyl-6-oxo-3-pyridinyl)phenyl]methyl]azetidin-3-yl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 154672600) has the molecular formula C39H44N6O7 and a molecular weight of 708.82 g/mol. Its IUPAC name is 5-[7-[[1-[[2,6-dimethoxy-4-(1-methyl-6-oxo-3-pyridinyl)phenyl]methyl]azetidin-3-yl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[7-[[1-[[2,6-dimethoxy-4-(1-methyl-6-oxo-3-pyridinyl)phenyl]methyl]azetidin-3-yl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 154672600 |
| Molecular Formula | C39H44N6O7 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | 5-[7-[[1-[[2,6-dimethoxy-4-(1-methyl-6-oxo-3-pyridinyl)phenyl]methyl]azetidin-3-yl]methyl]-2,7-diazaspiro[3.5]nonan-2-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc(-c2ccc(=O)n(C)c2)cc(OC)c1CN1CC(CN2CCC3(CC2)CN(c2ccc4c(c2)C(=O)N(C2CCC(=O)NC2=O)C4=O)C3)C1 |
| InChI | InChI=1S/C39H44N6O7/c1-41-20-25(4-9-35(41)47)26-14-32(51-2)30(33(15-26)52-3)21-43-18-24(19-43)17-42-12-10-39(11-13-42)22-44(23-39)27-5-6-28-29(16-27)38(50)45(37(28)49)31-7-8-34(46)40-36(31)48/h4-6,9,14-16,20,24,31H,7-8,10-13,17-19,21-23H2,1-3H3,(H,40,46,48) |
| InChIKey | URVOYSAWPBNSRL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|