C20H22ClN5O — CID 154673176
4-[4-(2-chloro-3-cyano-4-pyridinyl)-1,4-diazepan-1-yl]-N,N-dimethylbenzamide (PubChem CID 154673176) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-[4-(2-chloro-3-cyano-4-pyridinyl)-1,4-diazepan-1-yl]-N,N-dimethylbenzamide.
| Compound Name | 4-[4-(2-chloro-3-cyano-4-pyridinyl)-1,4-diazepan-1-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 154673176 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[4-(2-chloro-3-cyano-4-pyridinyl)-1,4-diazepan-1-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCCN(c3ccnc(Cl)c3C#N)CC2)cc1 |
| InChI | InChI=1S/C20H22ClN5O/c1-24(2)20(27)15-4-6-16(7-5-15)25-10-3-11-26(13-12-25)18-8-9-23-19(21)17(18)14-22/h4-9H,3,10-13H2,1-2H3 |
| InChIKey | PNDAFXYILKSMCH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|