C28H26F3N5O4S — CID 154675736
(1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]urea (PubChem CID 154675736) has the molecular formula C28H26F3N5O4S and a molecular weight of 585.61 g/mol. Its IUPAC name is (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]urea.
| Compound Name | (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]urea |
|---|---|
| PubChem CID | 154675736 |
| Molecular Formula | C28H26F3N5O4S |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]urea |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)Nc2ccc(NC(=O)Nc3ccc(OC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C28H26F3N5O4S/c1-16(2)22-13-4-17(3)14-23(22)36-24(37)15-41-27(36)35-26(39)34-19-7-5-18(6-8-19)32-25(38)33-20-9-11-21(12-10-20)40-28(29,30)31/h4-14,16H,15H2,1-3H3,(H,34,39)(H2,32,33,38)/b35-27- |
| InChIKey | QVCUDAKADSNEIW-LSWMGQQCSA-N |
| XLogP | 7.33 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|