C28H26F3N5O3S2 — CID 171926225
1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]phenyl]urea (PubChem CID 171926225) has the molecular formula C28H26F3N5O3S2 and a molecular weight of 601.68 g/mol. Its IUPAC name is 1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]phenyl]urea.
| Compound Name | 1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]phenyl]urea |
|---|---|
| PubChem CID | 171926225 |
| Molecular Formula | C28H26F3N5O3S2 |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | 1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]phenyl]urea |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CSC2=NC(=O)Nc2ccc(NC(=S)Nc3ccc(OC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C28H26F3N5O3S2/c1-16(2)22-13-4-17(3)14-23(22)36-24(37)15-41-27(36)35-25(38)32-18-5-7-19(8-6-18)33-26(40)34-20-9-11-21(12-10-20)39-28(29,30)31/h4-14,16H,15H2,1-3H3,(H,32,38)(H2,33,34,40) |
| InChIKey | XTNDXVLPVDWPOR-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|