C16H27OU- — CID 154676185
(1S,4R,4aS,8aS)-1-ethenyl-4,4a,7,8a-tetramethyl-1,2,3,4,5,6-hexahydronaphthalene;uranium;hydrate (PubChem CID 154676185) has the molecular formula C16H27OU- and a molecular weight of 473.42 g/mol. Its IUPAC name is (1S,4R,4aS,8aS)-1-ethenyl-4,4a,7,8a-tetramethyl-1,2,3,4,5,6-hexahydronaphthalene;uranium;hydrate.
| Compound Name | (1S,4R,4aS,8aS)-1-ethenyl-4,4a,7,8a-tetramethyl-1,2,3,4,5,6-hexahydronaphthalene;uranium;hydrate |
|---|---|
| PubChem CID | 154676185 |
| Molecular Formula | C16H27OU- |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (1S,4R,4aS,8aS)-1-ethenyl-4,4a,7,8a-tetramethyl-1,2,3,4,5,6-hexahydronaphthalene;uranium;hydrate |
| SMILES | C=[C-][C@@H]1CC[C@@H](C)[C@]2(C)CCC(C)=C[C@]12C.O.[U] |
| InChI | InChI=1S/C16H25.H2O.U/c1-6-14-8-7-13(3)15(4)10-9-12(2)11-16(14,15)5;;/h11,13-14H,1,7-10H2,2-5H3;1H2;/q-1;;/t13-,14-,15+,16-;;/m1../s1 |
| InChIKey | TZQGRVFALDUIQS-DZCPPAGBSA-N |
| XLogP | 3.95 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|