C13H22 — CID 142040575
(7aS)-3,3a,7a-trimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene (PubChem CID 142040575) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (7aS)-3,3a,7a-trimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene.
| Compound Name | (7aS)-3,3a,7a-trimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene |
|---|---|
| PubChem CID | 142040575 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (7aS)-3,3a,7a-trimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene |
| SMILES | C=C1CCCC2(C)C(C)CC[C@@]12C |
| InChI | InChI=1S/C13H22/c1-10-6-5-8-12(3)11(2)7-9-13(10,12)4/h11H,1,5-9H2,2-4H3/t11?,12?,13-/m0/s1 |
| InChIKey | KWIBTPNHULBHKC-BPCQOVAHSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|