C21H38 — CID 123648458
3-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene (PubChem CID 123648458) has the molecular formula C21H38 and a molecular weight of 290.53 g/mol. Its IUPAC name is 3-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene.
| Compound Name | 3-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene |
|---|---|
| PubChem CID | 123648458 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 3-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-7-methylidene-1,2,3,4,5,6-hexahydroindene |
| SMILES | C=C1CCCC2(C)C(C(C)CCCC(C)(C)C)CCC12C |
| InChI | InChI=1S/C21H38/c1-16(10-8-13-19(3,4)5)18-12-15-20(6)17(2)11-9-14-21(18,20)7/h16,18H,2,8-15H2,1,3-7H3 |
| InChIKey | YDHJQZNFEBJKEI-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|