C20H33NO2 — CID 143097338
(3aS,7aR)-3a-(ethenylideneamino)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,5,6,7-hexahydroinden-4-one (PubChem CID 143097338) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (3aS,7aR)-3a-(ethenylideneamino)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,5,6,7-hexahydroinden-4-one.
| Compound Name | (3aS,7aR)-3a-(ethenylideneamino)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,5,6,7-hexahydroinden-4-one |
|---|---|
| PubChem CID | 143097338 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (3aS,7aR)-3a-(ethenylideneamino)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,5,6,7-hexahydroinden-4-one |
| SMILES | C=C=N[C@@]12CCC([C@@H](C)CCCC(C)(C)O)[C@@]1(C)CCCC2=O |
| InChI | InChI=1S/C20H33NO2/c1-6-21-20-14-11-16(15(2)9-7-12-18(3,4)23)19(20,5)13-8-10-17(20)22/h15-16,23H,1,7-14H2,2-5H3/t15-,16?,19+,20+/m0/s1 |
| InChIKey | KJGLNOWBQXCWEZ-PZPGQKARSA-N |
| XLogP | 4.33 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|