C15H27NO2 — CID 122575805
2-methyl-6-(4-methyl-4-nitrosocyclohex-2-en-1-yl)heptan-2-ol (PubChem CID 122575805) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-methyl-6-(4-methyl-4-nitrosocyclohex-2-en-1-yl)heptan-2-ol.
| Compound Name | 2-methyl-6-(4-methyl-4-nitrosocyclohex-2-en-1-yl)heptan-2-ol |
|---|---|
| PubChem CID | 122575805 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-methyl-6-(4-methyl-4-nitrosocyclohex-2-en-1-yl)heptan-2-ol |
| SMILES | CC(CCCC(C)(C)O)C1C=CC(C)(N=O)CC1 |
| InChI | InChI=1S/C15H27NO2/c1-12(6-5-9-14(2,3)17)13-7-10-15(4,16-18)11-8-13/h7,10,12-13,17H,5-6,8-9,11H2,1-4H3 |
| InChIKey | ISEFQZIIVNHRRR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|