C29H48O — CID 123873101
5-[2-[1-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol (PubChem CID 123873101) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is 5-[2-[1-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol.
| Compound Name | 5-[2-[1-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 123873101 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 5-[2-[1-(6,6-dimethylheptan-2-yl)-3a,7a-dimethyl-1,2,3,5,6,7-hexahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1CCC(=CC=C2CCCC3(C)C(C(C)CCCC(C)(C)C)CCC23C)CC1O |
| InChI | InChI=1S/C29H48O/c1-21(10-8-17-27(3,4)5)25-16-19-28(6)24(11-9-18-29(25,28)7)15-14-23-13-12-22(2)26(30)20-23/h14-15,21,25-26,30H,2,8-13,16-20H2,1,3-7H3 |
| InChIKey | ZOLULZZNDFSZBB-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|