C14H26N2O4 — CID 15467720
[(1R,2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]cyclohexyl] acetate (PubChem CID 15467720) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(1R,2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]cyclohexyl] acetate.
| Compound Name | [(1R,2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]cyclohexyl] acetate |
|---|---|
| PubChem CID | 15467720 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [(1R,2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]cyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCCC[C@H]1N(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26N2O4/c1-10(17)19-12-9-7-6-8-11(12)16(5)15-13(18)20-14(2,3)4/h11-12H,6-9H2,1-5H3,(H,15,18)/t11-,12-/m1/s1 |
| InChIKey | MYSPDWIBQGBLNF-VXGBXAGGSA-N |
| XLogP | 2.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|