C18H40N2O — CID 154677969
ethane;1-ethyl-7-methoxy-4-methyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine;molecular hydrogen (PubChem CID 154677969) has the molecular formula C18H40N2O and a molecular weight of 300.53 g/mol. Its IUPAC name is ethane;1-ethyl-7-methoxy-4-methyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine;molecular hydrogen.
| Compound Name | ethane;1-ethyl-7-methoxy-4-methyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine;molecular hydrogen |
|---|---|
| PubChem CID | 154677969 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | ethane;1-ethyl-7-methoxy-4-methyl-1,2,3,5,6,7,8,9,10,10a-decahydrocycloocta[d]pyridazine;molecular hydrogen |
| SMILES | CC.CC.CCC1NNC(C)=C2CCC(OC)CCCC21.[H][H] |
| InChI | InChI=1S/C14H26N2O.2C2H6.H2/c1-4-14-13-7-5-6-11(17-3)8-9-12(13)10(2)15-16-14;2*1-2;/h11,13-16H,4-9H2,1-3H3;2*1-2H3;1H |
| InChIKey | VHRCGZONWDZMBA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |