C22H33N5O4 — CID 154678203
tert-butyl N-[6-[1-(cyclopentylmethyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate (PubChem CID 154678203) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is tert-butyl N-[6-[1-(cyclopentylmethyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[6-[1-(cyclopentylmethyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 154678203 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | tert-butyl N-[6-[1-(cyclopentylmethyl)pyrazol-4-yl]-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]carbamate |
| SMILES | COC(Cc1c(NC(=O)OC(C)(C)C)ncnc1-c1cnn(CC2CCCC2)c1)OC |
| InChI | InChI=1S/C22H33N5O4/c1-22(2,3)31-21(28)26-20-17(10-18(29-4)30-5)19(23-14-24-20)16-11-25-27(13-16)12-15-8-6-7-9-15/h11,13-15,18H,6-10,12H2,1-5H3,(H,23,24,26,28) |
| InChIKey | SNLSHVIYCBTNEI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|