C13H14F2O2 — CID 154678283
2,2-difluoro-3-hydroxy-3-(2-methylpropyl)inden-1-one (PubChem CID 154678283) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-(2-methylpropyl)inden-1-one.
| Compound Name | 2,2-difluoro-3-hydroxy-3-(2-methylpropyl)inden-1-one |
|---|---|
| PubChem CID | 154678283 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-(2-methylpropyl)inden-1-one |
| SMILES | CC(C)CC1(O)c2ccccc2C(=O)C1(F)F |
| InChI | InChI=1S/C13H14F2O2/c1-8(2)7-12(17)10-6-4-3-5-9(10)11(16)13(12,14)15/h3-6,8,17H,7H2,1-2H3 |
| InChIKey | AAGLCMDSIWHMCA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |