C22H27F3N2O2 — CID 154678647
2-[3-(dimethylamino)propyl]-6-ethoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 154678647) has the molecular formula C22H27F3N2O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]-6-ethoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[3-(dimethylamino)propyl]-6-ethoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154678647 |
| Molecular Formula | C22H27F3N2O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]-6-ethoxy-N-[4-methyl-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1cccc(CCCN(C)C)c1C(=O)Nc1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H27F3N2O2/c1-5-29-19-10-6-8-16(9-7-13-27(3)4)20(19)21(28)26-17-12-11-15(2)18(14-17)22(23,24)25/h6,8,10-12,14H,5,7,9,13H2,1-4H3,(H,26,28) |
| InChIKey | GSCWGYPABDTLFT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |