C20H22ClF3N2O2 — CID 129087176
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(dimethylamino)propoxy]-6-methylbenzamide (PubChem CID 129087176) has the molecular formula C20H22ClF3N2O2 and a molecular weight of 414.86 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(dimethylamino)propoxy]-6-methylbenzamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(dimethylamino)propoxy]-6-methylbenzamide |
|---|---|
| PubChem CID | 129087176 |
| Molecular Formula | C20H22ClF3N2O2 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(dimethylamino)propoxy]-6-methylbenzamide |
| SMILES | Cc1cccc(OCCCN(C)C)c1C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22ClF3N2O2/c1-13-6-4-7-17(28-11-5-10-26(2)3)18(13)19(27)25-14-8-9-16(21)15(12-14)20(22,23)24/h4,6-9,12H,5,10-11H2,1-3H3,(H,25,27) |
| InChIKey | FLENCTUBAJWRBJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|