C18H17ClF3NO2 — CID 43886287
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2-methylphenoxy)butanamide (PubChem CID 43886287) has the molecular formula C18H17ClF3NO2 and a molecular weight of 371.79 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2-methylphenoxy)butanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 43886287 |
| Molecular Formula | C18H17ClF3NO2 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2-methylphenoxy)butanamide |
| SMILES | CCC(Oc1ccccc1C)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17ClF3NO2/c1-3-15(25-16-7-5-4-6-11(16)2)17(24)23-12-8-9-14(19)13(10-12)18(20,21)22/h4-10,15H,3H2,1-2H3,(H,23,24) |
| InChIKey | SJIBUBZOPPTZPN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |