C21H17ClF3NO2 — CID 92680808
(2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 92680808) has the molecular formula C21H17ClF3NO2 and a molecular weight of 407.82 g/mol. Its IUPAC name is (2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 92680808 |
| Molecular Formula | C21H17ClF3NO2 |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (2S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17ClF3NO2/c1-2-19(28-16-9-7-13-5-3-4-6-14(13)11-16)20(27)26-15-8-10-18(22)17(12-15)21(23,24)25/h3-12,19H,2H2,1H3,(H,26,27)/t19-/m0/s1 |
| InChIKey | CXCXJTSMXREURN-IBGZPJMESA-N |
| XLogP | 6.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |