C27H31FN4O3 — CID 154679469
5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,3,3-trimethylpiperidin-4-yl)phenyl]-1,2-oxazole (PubChem CID 154679469) has the molecular formula C27H31FN4O3 and a molecular weight of 478.57 g/mol. Its IUPAC name is 5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,3,3-trimethylpiperidin-4-yl)phenyl]-1,2-oxazole.
| Compound Name | 5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,3,3-trimethylpiperidin-4-yl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 154679469 |
| Molecular Formula | C27H31FN4O3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,3,3-trimethylpiperidin-4-yl)phenyl]-1,2-oxazole |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C5CCN(C)CC5(C)C)cc4)no3)c2cc1F |
| InChI | InChI=1S/C27H31FN4O3/c1-27(2)16-32(3)10-9-20(27)17-5-7-18(8-6-17)22-14-25(35-31-22)26-19-13-21(28)24(34-12-11-33-4)15-23(19)29-30-26/h5-8,13-15,20H,9-12,16H2,1-4H3,(H,29,30) |
| InChIKey | IECGQANSTZXIFW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|