C21H20N6O3S — CID 154684663
(1S,5R,6R,7R)-7-[6-amino-2-[2-(5-methylthiophen-2-yl)ethynyl]purin-9-yl]-5,6-dihydroxy-N-methyltricyclo[4.1.0.02,4]heptane-4-carboxamide (PubChem CID 154684663) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is (1S,5R,6R,7R)-7-[6-amino-2-[2-(5-methylthiophen-2-yl)ethynyl]purin-9-yl]-5,6-dihydroxy-N-methyltricyclo[4.1.0.02,4]heptane-4-carboxamide.
| Compound Name | (1S,5R,6R,7R)-7-[6-amino-2-[2-(5-methylthiophen-2-yl)ethynyl]purin-9-yl]-5,6-dihydroxy-N-methyltricyclo[4.1.0.02,4]heptane-4-carboxamide |
|---|---|
| PubChem CID | 154684663 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (1S,5R,6R,7R)-7-[6-amino-2-[2-(5-methylthiophen-2-yl)ethynyl]purin-9-yl]-5,6-dihydroxy-N-methyltricyclo[4.1.0.02,4]heptane-4-carboxamide |
| SMILES | CNC(=O)C12CC1[C@H]1[C@@H](n3cnc4c(N)nc(C#Cc5ccc(C)s5)nc43)[C@@]1(O)[C@@H]2O |
| InChI | InChI=1S/C21H20N6O3S/c1-9-3-4-10(31-9)5-6-12-25-16(22)14-17(26-12)27(8-24-14)15-13-11-7-20(11,19(29)23-2)18(28)21(13,15)30/h3-4,8,11,13,15,18,28,30H,7H2,1-2H3,(H,23,29)(H2,22,25,26)/t11?,13-,15+,18+,20?,21+/m0/s1 |
| InChIKey | SZSYSFGPOJPCPH-SKATYLECSA-N |
| XLogP | 0.21 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|