C18H25N5OS — CID 154684743
3-[[5-(tert-butylamino)-2-(1-methylpyrazol-4-yl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol (PubChem CID 154684743) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 3-[[5-(tert-butylamino)-2-(1-methylpyrazol-4-yl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-(tert-butylamino)-2-(1-methylpyrazol-4-yl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 154684743 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-[[5-(tert-butylamino)-2-(1-methylpyrazol-4-yl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol |
| SMILES | Cn1cc(-c2cc3nc(NC(C)(C)C)cc(NCCCO)c3s2)cn1 |
| InChI | InChI=1S/C18H25N5OS/c1-18(2,3)22-16-9-13(19-6-5-7-24)17-14(21-16)8-15(25-17)12-10-20-23(4)11-12/h8-11,24H,5-7H2,1-4H3,(H2,19,21,22) |
| InChIKey | HKZYKCXVJYVDRV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|