C20H26N4OS — CID 154684781
3-[[5-(tert-butylamino)-2-(6-methyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol (PubChem CID 154684781) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 3-[[5-(tert-butylamino)-2-(6-methyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-(tert-butylamino)-2-(6-methyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 154684781 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-[[5-(tert-butylamino)-2-(6-methyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]amino]propan-1-ol |
| SMILES | Cc1cccc(-c2cc3nc(NC(C)(C)C)cc(NCCCO)c3s2)n1 |
| InChI | InChI=1S/C20H26N4OS/c1-13-7-5-8-14(22-13)17-11-16-19(26-17)15(21-9-6-10-25)12-18(23-16)24-20(2,3)4/h5,7-8,11-12,25H,6,9-10H2,1-4H3,(H2,21,23,24) |
| InChIKey | DYQNDIAFNAKKRC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|