C15H20ClN5 — CID 154687300
2-chloro-N-(5-spiro[2.3]hexan-5-yl-1H-pyrazol-3-yl)pyrimidin-4-amine;ethane (PubChem CID 154687300) has the molecular formula C15H20ClN5 and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-chloro-N-(5-spiro[2.3]hexan-5-yl-1H-pyrazol-3-yl)pyrimidin-4-amine;ethane.
| Compound Name | 2-chloro-N-(5-spiro[2.3]hexan-5-yl-1H-pyrazol-3-yl)pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 154687300 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-chloro-N-(5-spiro[2.3]hexan-5-yl-1H-pyrazol-3-yl)pyrimidin-4-amine;ethane |
| SMILES | CC.Clc1nccc(Nc2cc(C3CC4(CC4)C3)[nH]n2)n1 |
| InChI | InChI=1S/C13H14ClN5.C2H6/c14-12-15-4-1-10(17-12)16-11-5-9(18-19-11)8-6-13(7-8)2-3-13;1-2/h1,4-5,8H,2-3,6-7H2,(H2,15,16,17,18,19);1-2H3 |
| InChIKey | AFJMILCYLLYTOX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |