C26H31N9S — CID 154687303
1-[3-[3-[(2-aminopyrimidin-4-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]-3-(3-cyanophenyl)-1-cyclohexylthiourea (PubChem CID 154687303) has the molecular formula C26H31N9S and a molecular weight of 501.66 g/mol. Its IUPAC name is 1-[3-[3-[(2-aminopyrimidin-4-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]-3-(3-cyanophenyl)-1-cyclohexylthiourea.
| Compound Name | 1-[3-[3-[(2-aminopyrimidin-4-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]-3-(3-cyanophenyl)-1-cyclohexylthiourea |
|---|---|
| PubChem CID | 154687303 |
| Molecular Formula | C26H31N9S |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-[3-[3-[(2-aminopyrimidin-4-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]-3-(3-cyanophenyl)-1-cyclohexylthiourea |
| SMILES | N#Cc1cccc(NC(=S)N(C2CCCCC2)C2CCC(c3cc(Nc4ccnc(N)n4)n[nH]3)C2)c1 |
| InChI | InChI=1S/C26H31N9S/c27-16-17-5-4-6-19(13-17)30-26(36)35(20-7-2-1-3-8-20)21-10-9-18(14-21)22-15-24(34-33-22)31-23-11-12-29-25(28)32-23/h4-6,11-13,15,18,20-21H,1-3,7-10,14H2,(H,30,36)(H4,28,29,31,32,33,34) |
| InChIKey | ZNKRXEWGTLEUFG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|