C15H22N4O2 — CID 154687583
2-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]propan-2-amine (PubChem CID 154687583) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]propan-2-amine.
| Compound Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 154687583 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]triazol-4-yl]propan-2-amine |
| SMILES | COc1ccc(CCn2cc(C(C)(C)N)nn2)cc1OC |
| InChI | InChI=1S/C15H22N4O2/c1-15(2,16)14-10-19(18-17-14)8-7-11-5-6-12(20-3)13(9-11)21-4/h5-6,9-10H,7-8,16H2,1-4H3 |
| InChIKey | BQRIDBVGXFXZGW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |