C12H14INO4 — CID 154687929
iodo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 154687929) has the molecular formula C12H14INO4 and a molecular weight of 363.15 g/mol. Its IUPAC name is iodo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | iodo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 154687929 |
| Molecular Formula | C12H14INO4 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | iodo 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(OI)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H14INO4/c13-18-12(17)9-3-1-8(2-4-9)7-14-10(15)5-6-11(14)16/h5-6,8-9H,1-4,7H2 |
| InChIKey | LZHBTTXAOXIVRM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|