3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid

C11H13NO4 — CID 63042764

IUPAC3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCCC(N2C(=O)C=CC2=O)C1
InChIInChI=1S/C11H13NO4/c13-9-4-5-10(14)12(9)8-3-1-2-7(6-8)11(15)16/h4-5,7-8H,1-3,6H2,(H,15,16)
InChIKeyNGNRDUPRLDTUDW-UHFFFAOYSA-N
MW223.23 g/mol
LogP0.55
Rot. Bonds2

About 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid

3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 63042764) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid
PubChem CID63042764
Molecular FormulaC11H13NO4
Molecular Weight223.23 g/mol
Exact Mass223.08
IUPAC Name3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCCC(N2C(=O)C=CC2=O)C1
InChIInChI=1S/C11H13NO4/c13-9-4-5-10(14)12(9)8-3-1-2-7(6-8)11(15)16/h4-5,7-8H,1-3,6H2,(H,15,16)
InChIKeyNGNRDUPRLDTUDW-UHFFFAOYSA-N
XLogP0.55
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.23
LogP ≤ 50.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid (CID 63042764) is 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid is O=C(O)C1CCCC(N2C(=O)C=CC2=O)C1.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid?
The InChIKey is NGNRDUPRLDTUDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c13-9-4-5-10(14)12(9)8-3-1-2-7(6-8)11(15)16/h4-5,7-8H,1-3,6H2,(H,15,16).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid?
3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid has a molecular weight of 223.23 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 63042764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).