C12H17NO4 — CID 22568349
cyclohexanecarboxylic acid;1-methylpyrrole-2,5-dione (PubChem CID 22568349) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;1-methylpyrrole-2,5-dione.
| Compound Name | cyclohexanecarboxylic acid;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 22568349 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | cyclohexanecarboxylic acid;1-methylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C=CC1=O.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C7H12O2.C5H5NO2/c8-7(9)6-4-2-1-3-5-6;1-6-4(7)2-3-5(6)8/h6H,1-5H2,(H,8,9);2-3H,1H3 |
| InChIKey | BOCYHRZCSPKBPX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|