C22H35NO6 — CID 59709130
8-[3-(2,5-dioxopyrrol-1-yl)propyl]pentadecanedioic acid (PubChem CID 59709130) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is 8-[3-(2,5-dioxopyrrol-1-yl)propyl]pentadecanedioic acid.
| Compound Name | 8-[3-(2,5-dioxopyrrol-1-yl)propyl]pentadecanedioic acid |
|---|---|
| PubChem CID | 59709130 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 8-[3-(2,5-dioxopyrrol-1-yl)propyl]pentadecanedioic acid |
| SMILES | O=C(O)CCCCCCC(CCCCCCC(=O)O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H35NO6/c24-19-15-16-20(25)23(19)17-9-12-18(10-5-1-3-7-13-21(26)27)11-6-2-4-8-14-22(28)29/h15-16,18H,1-14,17H2,(H,26,27)(H,28,29) |
| InChIKey | NAEZMUBIXFLDJO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|