C12H16NO4+ — CID 18512668
4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 18512668) has the molecular formula C12H16NO4+ and a molecular weight of 238.26 g/mol. Its IUPAC name is 4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 18512668 |
| Molecular Formula | C12H16NO4+ |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylic acid |
| SMILES | C[N+]1(C2CCC(C(=O)O)CC2)C(=O)C=CC1=O |
| InChI | InChI=1S/C12H15NO4/c1-13(10(14)6-7-11(13)15)9-4-2-8(3-5-9)12(16)17/h6-9H,2-5H2,1H3/p+1 |
| InChIKey | MJIOTXMZEOTLDO-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|