C17H25NO4 — CID 123200108
4-(2,5-dioxopyrrol-1-yl)-1,2,2-triethylcyclohexane-1-carboxylic acid (PubChem CID 123200108) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-1,2,2-triethylcyclohexane-1-carboxylic acid.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-1,2,2-triethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123200108 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-1,2,2-triethylcyclohexane-1-carboxylic acid |
| SMILES | CCC1(CC)CC(N2C(=O)C=CC2=O)CCC1(CC)C(=O)O |
| InChI | InChI=1S/C17H25NO4/c1-4-16(5-2)11-12(18-13(19)7-8-14(18)20)9-10-17(16,6-3)15(21)22/h7-8,12H,4-6,9-11H2,1-3H3,(H,21,22) |
| InChIKey | ITLOEUGMDSXIHV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|