C12H15NO4 — CID 23325265
4-(2,5-dioxopyrrol-1-yl)-1-methylcyclohexane-1-carboxylic acid (PubChem CID 23325265) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 23325265 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-1-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(N2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H15NO4/c1-12(11(16)17)6-4-8(5-7-12)13-9(14)2-3-10(13)15/h2-3,8H,4-7H2,1H3,(H,16,17) |
| InChIKey | BKQBEQJZAPINSC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|