C16H20N2O7+2 — CID 22395215
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylate (PubChem CID 22395215) has the molecular formula C16H20N2O7+2 and a molecular weight of 352.34 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylate.
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 22395215 |
| Molecular Formula | C16H20N2O7+2 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)cyclohexane-1-carboxylate |
| SMILES | C[N+]1(C2CCC(C(=O)O[N+]3(O)C(=O)CCC3=O)CC2)C(=O)C=CC1=O |
| InChI | InChI=1S/C16H20N2O7/c1-17(12(19)6-7-13(17)20)11-4-2-10(3-5-11)16(23)25-18(24)14(21)8-9-15(18)22/h6-7,10-11,24H,2-5,8-9H2,1H3/q+2 |
| InChIKey | XEAICDYCOPBOKO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|