C11H13NO7S — CID 22620675
4-(2,5-dioxopyrrol-1-yl)-1-sulfocyclohexane-1-carboxylic acid (PubChem CID 22620675) has the molecular formula C11H13NO7S and a molecular weight of 303.29 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-1-sulfocyclohexane-1-carboxylic acid.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-1-sulfocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22620675 |
| Molecular Formula | C11H13NO7S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-1-sulfocyclohexane-1-carboxylic acid |
| SMILES | O=C1C=CC(=O)N1C1CCC(C(=O)O)(S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C11H13NO7S/c13-8-1-2-9(14)12(8)7-3-5-11(6-4-7,10(15)16)20(17,18)19/h1-2,7H,3-6H2,(H,15,16)(H,17,18,19) |
| InChIKey | CIERLMQKWGUBNF-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|