C26H30N4O8 — CID 154687954
benzyl (NE)-N-[[3-[2-methyl-2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminocarbamoyl]oxypropyl]phenyl]methoxycarbonylimino]carbamate (PubChem CID 154687954) has the molecular formula C26H30N4O8 and a molecular weight of 526.55 g/mol. Its IUPAC name is benzyl (NE)-N-[[3-[2-methyl-2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminocarbamoyl]oxypropyl]phenyl]methoxycarbonylimino]carbamate.
| Compound Name | benzyl (NE)-N-[[3-[2-methyl-2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminocarbamoyl]oxypropyl]phenyl]methoxycarbonylimino]carbamate |
|---|---|
| PubChem CID | 154687954 |
| Molecular Formula | C26H30N4O8 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | benzyl (NE)-N-[[3-[2-methyl-2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminocarbamoyl]oxypropyl]phenyl]methoxycarbonylimino]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=N/C(=O)OC(C)(C)Cc1cccc(COC(=O)/N=N/C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H30N4O8/c1-25(2,3)37-23(33)29-30-24(34)38-26(4,5)15-19-12-9-13-20(14-19)17-36-22(32)28-27-21(31)35-16-18-10-7-6-8-11-18/h6-14H,15-17H2,1-5H3/b28-27+,30-29+ |
| InChIKey | GDZHSWSYQXBJSU-XOXGWFOHSA-N |
| XLogP | 6.96 |
| TPSA | 154.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|