C18H17ClN6O3 — CID 154690721
N-[2-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide (PubChem CID 154690721) has the molecular formula C18H17ClN6O3 and a molecular weight of 400.83 g/mol. Its IUPAC name is N-[2-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154690721 |
| Molecular Formula | C18H17ClN6O3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[2-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(O)(O)c1cc(C(=O)NCCn2ccc(-c3ccc(C#N)c(Cl)c3)n2)n[nH]1 |
| InChI | InChI=1S/C18H17ClN6O3/c1-18(27,28)16-9-15(22-23-16)17(26)21-5-7-25-6-4-14(24-25)11-2-3-12(10-20)13(19)8-11/h2-4,6,8-9,27-28H,5,7H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | FHFJPMFSVVYYPR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 139.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|