C20H21ClN6O3 — CID 154690711
acetylene;N-[2-[[(Z)-3-amino-3-(3-chloro-4-cyanophenyl)prop-2-enylidene]amino]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide (PubChem CID 154690711) has the molecular formula C20H21ClN6O3 and a molecular weight of 428.88 g/mol. Its IUPAC name is acetylene;N-[2-[[(Z)-3-amino-3-(3-chloro-4-cyanophenyl)prop-2-enylidene]amino]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | acetylene;N-[2-[[(Z)-3-amino-3-(3-chloro-4-cyanophenyl)prop-2-enylidene]amino]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154690711 |
| Molecular Formula | C20H21ClN6O3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | acetylene;N-[2-[[(Z)-3-amino-3-(3-chloro-4-cyanophenyl)prop-2-enylidene]amino]ethyl]-5-(1,1-dihydroxyethyl)-1H-pyrazole-3-carboxamide |
| SMILES | C#C.CC(O)(O)c1cc(C(=O)NCC/N=C/C=C(\N)c2ccc(C#N)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C18H19ClN6O3.C2H2/c1-18(27,28)16-9-15(24-25-16)17(26)23-7-6-22-5-4-14(21)11-2-3-12(10-20)13(19)8-11;1-2/h2-5,8-9,27-28H,6-7,21H2,1H3,(H,23,26)(H,24,25);1-2H/b14-4-,22-5+; |
| InChIKey | VSZHKQNWEHFFQG-ONAHOPQVSA-N |
| XLogP | 1.14 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|