C45H50NOP — CID 154692170
3-[6-ethylphosphanyl-5-[2-(4-methylpentoxy)-6-phenylnaphthalen-1-yl]-8,8a-dihydronaphthalen-2-yl]benzonitrile;2-methylpropane (PubChem CID 154692170) has the molecular formula C45H50NOP and a molecular weight of 651.88 g/mol. Its IUPAC name is 3-[6-ethylphosphanyl-5-[2-(4-methylpentoxy)-6-phenylnaphthalen-1-yl]-8,8a-dihydronaphthalen-2-yl]benzonitrile;2-methylpropane.
| Compound Name | 3-[6-ethylphosphanyl-5-[2-(4-methylpentoxy)-6-phenylnaphthalen-1-yl]-8,8a-dihydronaphthalen-2-yl]benzonitrile;2-methylpropane |
|---|---|
| PubChem CID | 154692170 |
| Molecular Formula | C45H50NOP |
| Molecular Weight | 651.88 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | 3-[6-ethylphosphanyl-5-[2-(4-methylpentoxy)-6-phenylnaphthalen-1-yl]-8,8a-dihydronaphthalen-2-yl]benzonitrile;2-methylpropane |
| SMILES | CC(C)C.CCPC1=CCC2C=C(c3cccc(C#N)c3)C=CC2=C1c1c(OCCCC(C)C)ccc2cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C41H40NOP.C4H10/c1-4-44-39-22-18-35-26-33(31-14-8-11-29(24-31)27-42)16-20-37(35)41(39)40-36-19-15-32(30-12-6-5-7-13-30)25-34(36)17-21-38(40)43-23-9-10-28(2)3;1-4(2)3/h5-8,11-17,19-22,24-26,28,35,44H,4,9-10,18,23H2,1-3H3;4H,1-3H3 |
| InChIKey | ZGQGXQCUURNATM-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.88 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|