C40H32N2O4 — CID 164763709
3-[5-[6-(3-cyanophenyl)-2-(2-methoxyethoxy)naphthalen-1-yl]-6-(2-methoxyethoxy)naphthalen-2-yl]benzonitrile (PubChem CID 164763709) has the molecular formula C40H32N2O4 and a molecular weight of 604.71 g/mol. Its IUPAC name is 3-[5-[6-(3-cyanophenyl)-2-(2-methoxyethoxy)naphthalen-1-yl]-6-(2-methoxyethoxy)naphthalen-2-yl]benzonitrile.
| Compound Name | 3-[5-[6-(3-cyanophenyl)-2-(2-methoxyethoxy)naphthalen-1-yl]-6-(2-methoxyethoxy)naphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 164763709 |
| Molecular Formula | C40H32N2O4 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 3-[5-[6-(3-cyanophenyl)-2-(2-methoxyethoxy)naphthalen-1-yl]-6-(2-methoxyethoxy)naphthalen-2-yl]benzonitrile |
| SMILES | COCCOc1ccc2cc(-c3cccc(C#N)c3)ccc2c1-c1c(OCCOC)ccc2cc(-c3cccc(C#N)c3)ccc12 |
| InChI | InChI=1S/C40H32N2O4/c1-43-17-19-45-37-15-11-33-23-31(29-7-3-5-27(21-29)25-41)9-13-35(33)39(37)40-36-14-10-32(30-8-4-6-28(22-30)26-42)24-34(36)12-16-38(40)46-20-18-44-2/h3-16,21-24H,17-20H2,1-2H3 |
| InChIKey | CJVNTNLVXGJLQY-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|