C38H28N2O4 — CID 155635706
2-[1-[2-(2-hydroxyethoxy)-6-(3-isocyanophenyl)naphthalen-1-yl]-6-(3-isocyanophenyl)naphthalen-2-yl]oxyethanol (PubChem CID 155635706) has the molecular formula C38H28N2O4 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2-[1-[2-(2-hydroxyethoxy)-6-(3-isocyanophenyl)naphthalen-1-yl]-6-(3-isocyanophenyl)naphthalen-2-yl]oxyethanol.
| Compound Name | 2-[1-[2-(2-hydroxyethoxy)-6-(3-isocyanophenyl)naphthalen-1-yl]-6-(3-isocyanophenyl)naphthalen-2-yl]oxyethanol |
|---|---|
| PubChem CID | 155635706 |
| Molecular Formula | C38H28N2O4 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 2-[1-[2-(2-hydroxyethoxy)-6-(3-isocyanophenyl)naphthalen-1-yl]-6-(3-isocyanophenyl)naphthalen-2-yl]oxyethanol |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(-c4c(OCCO)ccc5cc(-c6cccc([N+]#[C-])c6)ccc45)c(OCCO)ccc3c2)c1 |
| InChI | InChI=1S/C38H28N2O4/c1-39-31-7-3-5-25(23-31)27-9-13-33-29(21-27)11-15-35(43-19-17-41)37(33)38-34-14-10-28(26-6-4-8-32(24-26)40-2)22-30(34)12-16-36(38)44-20-18-42/h3-16,21-24,41-42H,17-20H2 |
| InChIKey | BTIRYMFMFCUIAF-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|