C18H17N3O2 — CID 154693152
5-[(4-methoxyphenyl)methyl]-N-phenyl-1H-pyrazole-3-carboxamide (PubChem CID 154693152) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-N-phenyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-N-phenyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154693152 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-N-phenyl-1H-pyrazole-3-carboxamide |
| SMILES | COc1ccc(Cc2cc(C(=O)Nc3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H17N3O2/c1-23-16-9-7-13(8-10-16)11-15-12-17(21-20-15)18(22)19-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | KFJIJGOBAICPGD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |